Type: Neutral
Formula: C11H20N2O8
SMILES: |
OC(C(NC(=O)C)C(=O)CC(N)C(O)=O)C(O)C(O)CO |
InChI: |
InChI=1/C11H20N2O8/c1-4(15)13-8(6(16)2-5(12)11(20)21)10(19)9(18)7(17)3-14/h5,7-10,14,17-19H,2-3,12H2,1H3,(H,13,15)(H,20,21)/t5-,7-,8-,9-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 308.287 g/mol | logS: 1.13922 | SlogP: -4.0628 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0954114 | Sterimol/B1: 2.07842 | Sterimol/B2: 3.23093 | Sterimol/B3: 3.86032 |
Sterimol/B4: 8.63208 | Sterimol/L: 14.6849 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 519.913 | Positive charged surface: 344.218 | Negative charged surface: 175.694 | Volume: 263 |
Hydrophobic surface: 185.104 | Hydrophilic surface: 334.809 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |