Type: Neutral
Formula: C12H16N2O4S
SMILES: |
S1C(CO)C(O)CC1N1C=C(C(C)=C)C(=O)NC1=O |
InChI: |
InChI=1/C12H16N2O4S/c1-6(2)7-4-14(12(18)13-11(7)17)10-3-8(16)9(5-15)19-10/h4,8-10,15-16H,1,3,5H2,2H3,(H,13,17,18)/t8-,9+,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.336 g/mol | logS: -2.27487 | SlogP: 0.183 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.110658 | Sterimol/B1: 3.33263 | Sterimol/B2: 3.44233 | Sterimol/B3: 4.43035 |
Sterimol/B4: 4.43238 | Sterimol/L: 14.4877 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 486.166 | Positive charged surface: 315.065 | Negative charged surface: 171.101 | Volume: 250.375 |
Hydrophobic surface: 244.645 | Hydrophilic surface: 241.521 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |