 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2CCC(=O)NC2=O)CC1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C9H15N2O8P/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17/h5-6,8,12H,1-4H2,(H,10,13,14)(H2,15,16,17)/p-2/t5-,6+,8+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-26.8191 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 308.183 g/mol | logS: 0.18407 | SlogP: -3.8207 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.128199 | Sterimol/B1: 2.44317 | Sterimol/B2: 2.60707 | Sterimol/B3: 4.36108 | |||
| Sterimol/B4: 6.20769 | Sterimol/L: 13.7111 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 475.012 | Positive charged surface: 244.174 | Negative charged surface: 230.838 | Volume: 233.25 | |||
| Hydrophobic surface: 162.538 | Hydrophilic surface: 312.474 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
