Type: Neutral
Formula: C7H16O7P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(O)C1CCCCC1 |
InChI: |
InChI=1/C7H16O7P2/c8-7(15(9,10)11,16(12,13)14)6-4-2-1-3-5-6/h6,8H,1-5H2,(H2,9,10,11)(H2,12,13,14) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.146 g/mol | logS: -0.33525 | SlogP: -1.5722 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.297646 | Sterimol/B1: 3.40383 | Sterimol/B2: 4.1397 | Sterimol/B3: 4.3411 |
Sterimol/B4: 4.53162 | Sterimol/L: 11.328 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 406.733 | Positive charged surface: 258.563 | Negative charged surface: 148.171 | Volume: 209.125 |
Hydrophobic surface: 165.601 | Hydrophilic surface: 241.132 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |