Type: Neutral
Formula: C10H15N5O5
SMILES: |
OC(C(O)C(O)C(O)CO)C=1N=C2N=CN=C(N)C2N=1 |
InChI: |
InChI=1/C10H15N5O5/c11-8-4-9(13-2-12-8)15-10(14-4)7(20)6(19)5(18)3(17)1-16/h2-7,16-20H,1H2,(H2,11,12,13,14,15)/t3-,4+,5-,6-,7-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 285.26 g/mol | logS: -0.59137 | SlogP: -3.9994 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0743032 | Sterimol/B1: 2.24103 | Sterimol/B2: 3.27551 | Sterimol/B3: 4.07254 |
Sterimol/B4: 5.56027 | Sterimol/L: 15.5217 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 487.15 | Positive charged surface: 350.87 | Negative charged surface: 136.281 | Volume: 238.375 |
Hydrophobic surface: 128.2 | Hydrophilic surface: 358.95 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |