Type: Neutral
Formula: C12H16N2O4S
SMILES: |
S1C(CO)C(O)CC1N1C=C(\C=C\C)C(=O)NC1=O |
InChI: |
InChI=1/C12H16N2O4S/c1-2-3-7-5-14(12(18)13-11(7)17)10-4-8(16)9(6-15)19-10/h2-3,5,8-10,15-16H,4,6H2,1H3,(H,13,17,18)/b3-2+/t8-,9+,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.336 g/mol | logS: -2.27487 | SlogP: 0.183 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0685906 | Sterimol/B1: 3.19975 | Sterimol/B2: 3.52453 | Sterimol/B3: 4.11478 |
Sterimol/B4: 4.45141 | Sterimol/L: 15.694 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 489.626 | Positive charged surface: 326.254 | Negative charged surface: 163.372 | Volume: 249.125 |
Hydrophobic surface: 272.589 | Hydrophilic surface: 217.037 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |