Type: Neutral
Formula: C13H20N2O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(CCCC)C(=O)NC1=O |
InChI: |
InChI=1/C13H20N2O6/c1-2-3-4-7-5-15(13(20)14-11(7)19)12-10(18)9(17)8(6-16)21-12/h5,8-10,12,16-18H,2-4,6H2,1H3,(H,14,19,20)/t8-,9-,10-,12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 300.311 g/mol | logS: -1.43426 | SlogP: -0.9487 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.117305 | Sterimol/B1: 2.58712 | Sterimol/B2: 3.6132 | Sterimol/B3: 5.85265 |
Sterimol/B4: 5.86506 | Sterimol/L: 15.7446 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 533.511 | Positive charged surface: 380.965 | Negative charged surface: 152.546 | Volume: 268.25 |
Hydrophobic surface: 262.767 | Hydrophilic surface: 270.744 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |