Type: Neutral
Formula: C20H30O4
SMILES: |
O1C2CC(CCC3(OC3CC\C(=C\CCC2(O)C)\C)C)C(=C)C1=O |
InChI: |
InChI=1/C20H30O4/c1-13-6-5-10-19(3,22)17-12-15(14(2)18(21)23-17)9-11-20(4)16(24-20)8-7-13/h6,15-17,22H,2,5,7-12H2,1,3-4H3/b13-6-/t15-,16+,17+,19-,20-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.456 g/mol | logS: -2.91096 | SlogP: 3.6833 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.148862 | Sterimol/B1: 2.54659 | Sterimol/B2: 4.2272 | Sterimol/B3: 4.838 |
Sterimol/B4: 7.60954 | Sterimol/L: 13.1851 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 543.373 | Positive charged surface: 347.033 | Negative charged surface: 196.34 | Volume: 342.5 |
Hydrophobic surface: 384.614 | Hydrophilic surface: 158.759 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |