Type: Neutral
Formula: C6H13NO8S
SMILES: |
S(OCC1OC(O)C(N)C(O)C1O)(O)(=O)=O |
InChI: |
InChI=1/C6H13NO8S/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13/h2-6,8-10H,1,7H2,(H,11,12,13)/t2-,3-,4-,5+,6+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 259.235 g/mol | logS: 0.8784 | SlogP: -3.9936 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.105992 | Sterimol/B1: 2.98262 | Sterimol/B2: 3.494 | Sterimol/B3: 4.0767 |
Sterimol/B4: 4.30498 | Sterimol/L: 12.7534 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 411.81 | Positive charged surface: 257.407 | Negative charged surface: 154.403 | Volume: 186.875 |
Hydrophobic surface: 99.1742 | Hydrophilic surface: 312.6358 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |