 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OC1C(O)C([NH3+])C(OC1CO)O)(=O)([O-])[O-] |
| InChI: | InChI=1/C6H14NO8P/c7-3-4(9)5(15-16(11,12)13)2(1-8)14-6(3)10/h2-6,8-10H,1,7H2,(H2,11,12,13)/p-1/t2-,3-,4-,5-,6-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-17.0112 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 258.143 g/mol | logS: 1.44982 | SlogP: -6.189 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.124758 | Sterimol/B1: 2.82591 | Sterimol/B2: 3.09876 | Sterimol/B3: 3.13365 | |||
| Sterimol/B4: 6.86838 | Sterimol/L: 10.717 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 396.612 | Positive charged surface: 227.505 | Negative charged surface: 169.107 | Volume: 187.5 | |||
| Hydrophobic surface: 104.117 | Hydrophilic surface: 292.495 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
