Type: Neutral
Formula: C6H13NO8S
SMILES: |
S(OCC1OC(O)C(N)C(O)C1O)(O)(=O)=O |
InChI: |
InChI=1/C6H13NO8S/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13/h2-6,8-10H,1,7H2,(H,11,12,13)/t2-,3+,4+,5-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 259.235 g/mol | logS: 0.8784 | SlogP: -3.9936 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.144924 | Sterimol/B1: 3.06895 | Sterimol/B2: 3.12633 | Sterimol/B3: 3.59923 |
Sterimol/B4: 5.35682 | Sterimol/L: 11.988 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 416.034 | Positive charged surface: 266.17 | Negative charged surface: 149.864 | Volume: 189 |
Hydrophobic surface: 102.276 | Hydrophilic surface: 313.758 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |