Type: Neutral
Formula: C10H18N3O6S+
SMILES: |
[SH2+]CC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O |
InChI: |
InChI=1/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/p+1/t5-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 308.335 g/mol | logS: -0.68277 | SlogP: -3.1244 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0346697 | Sterimol/B1: 2.77029 | Sterimol/B2: 3.4576 | Sterimol/B3: 4.07931 |
Sterimol/B4: 5.20995 | Sterimol/L: 17.9424 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 547.745 | Positive charged surface: 341.996 | Negative charged surface: 205.749 | Volume: 259.375 |
Hydrophobic surface: 204.183 | Hydrophilic surface: 343.562 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 1 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |