Type: Neutral
Formula: C13H13BrN2O5
SMILES: |
Br\C=C\C1=CN(C2OC(C#C)(CO)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C13H13BrN2O5/c1-2-13(7-17)9(18)5-10(21-13)16-6-8(3-4-14)11(19)15-12(16)20/h1,3-4,6,9-10,17-18H,5,7H2,(H,15,19,20)/b4-3+/t9-,10+,13+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 357.16 g/mol | logS: -2.5703 | SlogP: -0.088792 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.120085 | Sterimol/B1: 2.45117 | Sterimol/B2: 3.04477 | Sterimol/B3: 5.13676 |
Sterimol/B4: 6.74961 | Sterimol/L: 15.359 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 537.333 | Positive charged surface: 261.964 | Negative charged surface: 275.368 | Volume: 275.125 |
Hydrophobic surface: 342.212 | Hydrophilic surface: 195.121 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |