Type: Neutral
Formula: C10H12N4O5S
SMILES: |
S=C1NC2=C(NC=NC2=O)N1C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C10H12N4O5S/c15-1-3-5(16)6(17)9(19-3)14-7-4(13-10(14)20)8(18)12-2-11-7/h2-3,5-6,9,15-17H,1H2,(H,13,20)(H,11,12,18)/t3-,5-,6-,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 300.295 g/mol | logS: -2.058 | SlogP: -3.0573 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.131696 | Sterimol/B1: 2.57691 | Sterimol/B2: 2.76912 | Sterimol/B3: 4.77767 |
Sterimol/B4: 6.0871 | Sterimol/L: 13.0544 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 463.834 | Positive charged surface: 305.069 | Negative charged surface: 158.766 | Volume: 236 |
Hydrophobic surface: 107.281 | Hydrophilic surface: 356.553 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |