Type: Neutral
Formula: C16H22N3O+
SMILES: |
O=C(NCCC[n+]1cc[nH]c1)C(CC)c1ccccc1 |
InChI: |
InChI=1/C16H21N3O/c1-2-15(14-7-4-3-5-8-14)16(20)18-9-6-11-19-12-10-17-13-19/h3-5,7-8,10,12-13,15H,2,6,9,11H2,1H3,(H,18,20)/p+1/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.372 g/mol | logS: -2.77942 | SlogP: 2.2687 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0627335 | Sterimol/B1: 2.34555 | Sterimol/B2: 3.50985 | Sterimol/B3: 3.86374 |
Sterimol/B4: 6.33029 | Sterimol/L: 17.5167 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 555.635 | Positive charged surface: 434.951 | Negative charged surface: 120.685 | Volume: 287.875 |
Hydrophobic surface: 397.009 | Hydrophilic surface: 158.626 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 2 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |