 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)C(NC(=O)CC)c1ccccc1 |
| InChI: | InChI=1/C19H23N3O5S/c1-4-11(23)20-12(10-8-6-5-7-9-10)15(24)21-13-16(25)22-14(18(26)27)19(2,3)28-17(13)22/h5-9,12-14,17H,4H2,1-3H3,(H,20,23)(H,21,24)(H,26,27)/p-1/t12-,13+,14-,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.2194 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.467 g/mol | logS: -4.06029 | SlogP: -0.3536 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.103706 | Sterimol/B1: 3.23473 | Sterimol/B2: 4.5723 | Sterimol/B3: 5.17054 | |||
| Sterimol/B4: 6.08746 | Sterimol/L: 17.3217 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 624.178 | Positive charged surface: 332.375 | Negative charged surface: 258.82 | Volume: 368.375 | |||
| Hydrophobic surface: 367.191 | Hydrophilic surface: 256.987 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
