 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(N)c2c3c(sc2)cccc3)C(C(=O)[O-])=C(C1)C |
| InChI: | InChI=1/C18H17N3O4S2/c1-8-6-27-17-13(16(23)21(17)14(8)18(24)25)20-15(22)12(19)10-7-26-11-5-3-2-4-9(10)11/h2-5,7,12-13,17H,6,19H2,1H3,(H,20,22)(H,24,25)/p-1/t12-,13+,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=93.5736 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 402.475 g/mol | logS: -4.80428 | SlogP: 0.4204 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.17251 | Sterimol/B1: 3.22182 | Sterimol/B2: 4.64406 | Sterimol/B3: 5.62986 | |||
| Sterimol/B4: 6.58542 | Sterimol/L: 14.2531 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 614.19 | Positive charged surface: 265.859 | Negative charged surface: 310.998 | Volume: 347.25 | |||
| Hydrophobic surface: 372.18 | Hydrophilic surface: 242.01 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
