Type: Neutral
Formula: C10H14N2O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O6/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 258.23 g/mol | logS: 0.1114 | SlogP: -2.119 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.131156 | Sterimol/B1: 3.02839 | Sterimol/B2: 3.31578 | Sterimol/B3: 4.79459 |
Sterimol/B4: 4.81656 | Sterimol/L: 12.8704 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 442.503 | Positive charged surface: 306.167 | Negative charged surface: 136.336 | Volume: 216 |
Hydrophobic surface: 201.17 | Hydrophilic surface: 241.333 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |