Type: Neutral
Formula: C17H20O3
SMILES: |
O1CC2C3C(CCC2(C)C1=O)c1c(cc(O)cc1)CC3 |
InChI: |
InChI=1/C17H20O3/c1-17-7-6-13-12-5-3-11(18)8-10(12)2-4-14(13)15(17)9-20-16(17)19/h3,5,8,13-15,18H,2,4,6-7,9H2,1H3/t13-,14+,15+,17+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.344 g/mol | logS: -3.79226 | SlogP: 3.01127 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.12119 | Sterimol/B1: 2.18433 | Sterimol/B2: 4.02089 | Sterimol/B3: 4.14038 |
Sterimol/B4: 4.96687 | Sterimol/L: 14.0954 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 458.633 | Positive charged surface: 303.917 | Negative charged surface: 154.716 | Volume: 262.25 |
Hydrophobic surface: 329.035 | Hydrophilic surface: 129.598 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |