 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(OC2C(O)C(N(C(=O)CN)C)C(OC)CC2N)C(N)CCC1C(N)C |
| InChI: | InChI=1/C17H35N5O5/c1-8(19)11-5-4-9(20)17(26-11)27-16-10(21)6-12(25-3)14(15(16)24)22(2)13(23)7-18/h8-12,14-17,24H,4-7,18-21H2,1-3H3/t8-,9-,10+,11-,12-,14-,15-,16+,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=253.391 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 389.497 g/mol | logS: 0.24113 | SlogP: -2.5562 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.20845 | Sterimol/B1: 2.18608 | Sterimol/B2: 4.61221 | Sterimol/B3: 4.88684 | |||
| Sterimol/B4: 7.99857 | Sterimol/L: 15.0929 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 591.069 | Positive charged surface: 509.105 | Negative charged surface: 81.9642 | Volume: 368 | |||
| Hydrophobic surface: 362.222 | Hydrophilic surface: 228.847 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 9 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
