Type: Neutral
Formula: C15H18O5
SMILES: |
O1C(O)C23C(C4CC(CC4(O)C=C2C=O)(C)C)(C3)C1=O |
InChI: |
InChI=1/C15H18O5/c1-12(2)4-9-13(19,6-12)3-8(5-16)14-7-15(9,14)11(18)20-10(14)17/h3,5,9-10,17,19H,4,6-7H2,1-2H3/t9-,10-,13+,14-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.304 g/mol | logS: -1.79361 | SlogP: 0.5443 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.24874 | Sterimol/B1: 2.70637 | Sterimol/B2: 4.40489 | Sterimol/B3: 5.16554 |
Sterimol/B4: 5.39881 | Sterimol/L: 11.5481 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 451.728 | Positive charged surface: 302.781 | Negative charged surface: 148.947 | Volume: 255.125 |
Hydrophobic surface: 225.222 | Hydrophilic surface: 226.506 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |