Type: Neutral
Formula: C15H18O5
SMILES: |
O1C(O)C23C(C4CC(CC4(O)C=C2C=O)(C)C)(C3)C1=O |
InChI: |
InChI=1/C15H18O5/c1-12(2)4-9-13(19,6-12)3-8(5-16)14-7-15(9,14)11(18)20-10(14)17/h3,5,9-10,17,19H,4,6-7H2,1-2H3/t9-,10+,13-,14+,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.304 g/mol | logS: -1.79361 | SlogP: 0.5443 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.272562 | Sterimol/B1: 3.9528 | Sterimol/B2: 4.01082 | Sterimol/B3: 4.46213 |
Sterimol/B4: 6.13151 | Sterimol/L: 11.4842 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 448.235 | Positive charged surface: 296.111 | Negative charged surface: 152.124 | Volume: 254.25 |
Hydrophobic surface: 205.519 | Hydrophilic surface: 242.716 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |