Type: Neutral
Formula: C18H24N2O4
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(C)C)C(=O)N1CCCC1C=O |
InChI: |
InChI=1/C18H24N2O4/c1-13(2)16(17(22)20-10-6-9-15(20)11-21)19-18(23)24-12-14-7-4-3-5-8-14/h3-5,7-8,11,13,15-16H,6,9-10,12H2,1-2H3,(H,19,23)/t15-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 332.4 g/mol | logS: -2.99009 | SlogP: 2.3937 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0799693 | Sterimol/B1: 2.45382 | Sterimol/B2: 3.60738 | Sterimol/B3: 4.29767 |
Sterimol/B4: 7.1061 | Sterimol/L: 17.6936 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 598.073 | Positive charged surface: 380.633 | Negative charged surface: 217.44 | Volume: 325 |
Hydrophobic surface: 441.709 | Hydrophilic surface: 156.364 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |