Type: Neutral
Formula: C13H19NOS
SMILES: |
s1cccc1CC(=O)NC1CCCCC1C |
InChI: |
InChI=1/C13H19NOS/c1-10-5-2-3-7-12(10)14-13(15)9-11-6-4-8-16-11/h4,6,8,10,12H,2-3,5,7,9H2,1H3,(H,14,15)/t10-,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 237.367 g/mol | logS: -3.07206 | SlogP: 2.98547 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0947211 | Sterimol/B1: 1.9708 | Sterimol/B2: 3.28052 | Sterimol/B3: 3.468 |
Sterimol/B4: 6.85211 | Sterimol/L: 13.7493 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 470.686 | Positive charged surface: 296.542 | Negative charged surface: 174.144 | Volume: 238.375 |
Hydrophobic surface: 427.573 | Hydrophilic surface: 43.113 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |