 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(OC3OC(CC(=O)C13O)C)C([O-])C([NH2+]C)C([O-])C2[NH2+]C |
| InChI: | InChI=1/C14H22N2O7/c1-5-4-6(17)14(20)13(21-5)22-12-10(19)7(15-2)9(18)8(16-3)11(12)23-14/h5,7-13,15-16,20H,4H2,1-3H3/q-2/p+2/t5-,7-,8+,9-,10+,11-,12-,13+,14+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=50.8301 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 332.353 g/mol | logS: 0.03733 | SlogP: -4.1016 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.142981 | Sterimol/B1: 2.39627 | Sterimol/B2: 3.20792 | Sterimol/B3: 5.70938 | |||
| Sterimol/B4: 7.89936 | Sterimol/L: 14.2166 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 531.969 | Positive charged surface: 391.437 | Negative charged surface: 140.532 | Volume: 296 | |||
| Hydrophobic surface: 273.417 | Hydrophilic surface: 258.552 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 2 | |||
| Chiral centers: 9 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
