Type: Neutral
Formula: C3H11O9P3
SMILES: |
P(O)(O)(=O)C(CP(O)(O)=O)CP(O)(O)=O |
InChI: |
InChI=1/C3H11O9P3/c4-13(5,6)1-3(15(10,11)12)2-14(7,8)9/h3H,1-2H2,(H2,4,5,6)(H2,7,8,9)(H2,10,11,12) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.034 g/mol | logS: 2.41802 | SlogP: -4.3225 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.221853 | Sterimol/B1: 2.80409 | Sterimol/B2: 3.59772 | Sterimol/B3: 4.14422 |
Sterimol/B4: 4.71099 | Sterimol/L: 10.8169 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 402.059 | Positive charged surface: 208.007 | Negative charged surface: 194.052 | Volume: 187.25 |
Hydrophobic surface: 48.6655 | Hydrophilic surface: 353.3935 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 9 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |