Type: Neutral
Formula: C25H29N4O2+
SMILES: |
O=C(N\C(=C/c1ccc(cc1)C(C)C)\C(=O)NCCC[n+]1cc[nH]c1)c1ccccc1 |
InChI: |
InChI=1/C25H28N4O2/c1-19(2)21-11-9-20(10-12-21)17-23(28-24(30)22-7-4-3-5-8-22)25(31)27-13-6-15-29-16-14-26-18-29/h3-5,7-12,14,16-19H,6,13,15H2,1-2H3,(H2,27,28,30,31)/p+1/b23-17- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 417.533 g/mol | logS: -6.01716 | SlogP: 3.6694 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0419456 | Sterimol/B1: 2.29009 | Sterimol/B2: 4.9243 | Sterimol/B3: 5.06485 |
Sterimol/B4: 7.49382 | Sterimol/L: 20.5892 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 750.409 | Positive charged surface: 531.718 | Negative charged surface: 218.691 | Volume: 424.5 |
Hydrophobic surface: 542.285 | Hydrophilic surface: 208.124 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 2 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |