Type: Ionized
Formula: C14H18NO4-
SMILES: |
O1CCCC1CNC(=O)C1C2CC(C=C2)C1C(=O)[O-] |
InChI: |
InChI=1/C14H19NO4/c16-13(15-7-10-2-1-5-19-10)11-8-3-4-9(6-8)12(11)14(17)18/h3-4,8-12H,1-2,5-7H2,(H,15,16)(H,17,18)/p-1/t8-,9+,10-,11-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 264.301 g/mol | logS: -1.05906 | SlogP: -0.5302 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.11539 | Sterimol/B1: 3.47549 | Sterimol/B2: 3.61505 | Sterimol/B3: 3.81265 |
Sterimol/B4: 5.17425 | Sterimol/L: 13.6648 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 467.857 | Positive charged surface: 331.531 | Negative charged surface: 136.327 | Volume: 247.75 |
Hydrophobic surface: 335.825 | Hydrophilic surface: 132.032 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|