 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C([O-])c1c2c(ncnc2NC(C(CC)C)C(=O)[O-])ccc1 |
| InChI: | InChI=1/C15H17N3O4/c1-3-8(2)12(15(21)22)18-13-11-9(14(19)20)5-4-6-10(11)16-7-17-13/h4-8,12H,3H2,1-2H3,(H,19,20)(H,21,22)(H,16,17,18)/p-2/t8-,12-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=73.4971 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 301.302 g/mol | logS: -3.97425 | SlogP: -0.4302 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0596156 | Sterimol/B1: 2.3962 | Sterimol/B2: 4.85946 | Sterimol/B3: 4.89544 | |||
| Sterimol/B4: 5.88638 | Sterimol/L: 14.9397 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 501.916 | Positive charged surface: 280.086 | Negative charged surface: 216.138 | Volume: 273.75 | |||
| Hydrophobic surface: 281.108 | Hydrophilic surface: 220.808 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
