 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | ClCC(=O)C(NC(C(=O)NC(=O)C(N)Cc1ccccc1)C)CCCN=C(N)N |
| InChI: | InChI=1/C19H29ClN6O3/c1-12(25-15(16(27)11-20)8-5-9-24-19(22)23)17(28)26-18(29)14(21)10-13-6-3-2-4-7-13/h2-4,6-7,12,14-15,25H,5,8-11,21H2,1H3,(H4,22,23,24)(H,26,28,29)/t12-,14-,15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=90.1667 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 424.933 g/mol | logS: -3.58601 | SlogP: -0.59263 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0543918 | Sterimol/B1: 3.06415 | Sterimol/B2: 4.53564 | Sterimol/B3: 4.94202 | |||
| Sterimol/B4: 9.81042 | Sterimol/L: 18.6798 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 746.045 | Positive charged surface: 457.553 | Negative charged surface: 288.493 | Volume: 399.25 | |||
| Hydrophobic surface: 385.723 | Hydrophilic surface: 360.322 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
