 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CC(C)C)C(=O)[O-])C(NC(=O)Nc1c2c(ccc1)cccc2)CC(C)C |
| InChI: | InChI=1/C23H31N3O4/c1-14(2)12-19(21(27)24-20(22(28)29)13-15(3)4)26-23(30)25-18-11-7-9-16-8-5-6-10-17(16)18/h5-11,14-15,19-20H,12-13H2,1-4H3,(H,24,27)(H,28,29)(H2,25,26,30)/p-1/t19-,20-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=61.635 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 412.51 g/mol | logS: -6.85377 | SlogP: 2.6568 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0837005 | Sterimol/B1: 2.17307 | Sterimol/B2: 2.53125 | Sterimol/B3: 5.44092 | |||
| Sterimol/B4: 10.8518 | Sterimol/L: 18.3086 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 732.281 | Positive charged surface: 435.754 | Negative charged surface: 285.168 | Volume: 416.375 | |||
| Hydrophobic surface: 526.905 | Hydrophilic surface: 205.376 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
