 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C[NH3+])C(O)C(OC)C(N)C1OC1C(O)C(O)C([NH3+])CC1[NH3+] |
| InChI: | InChI=1/C13H28N4O6/c1-21-12-7(17)13(22-6(3-14)9(12)19)23-11-5(16)2-4(15)8(18)10(11)20/h4-13,18-20H,2-3,14-17H2,1H3/p+3/t4-,5+,6+,7+,8-,9-,10-,11+,12+,13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=100.013 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 339.413 g/mol | logS: 1.51671 | SlogP: -6.6119 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.124327 | Sterimol/B1: 2.59052 | Sterimol/B2: 3.6568 | Sterimol/B3: 3.8851 | |||
| Sterimol/B4: 8.41296 | Sterimol/L: 14.1531 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 557.278 | Positive charged surface: 507.149 | Negative charged surface: 50.1291 | Volume: 314.625 | |||
| Hydrophobic surface: 257.648 | Hydrophilic surface: 299.63 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 10 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
