Type: Neutral
Formula: C20H17N5OS
SMILES: |
s1c2cc(ccc2nc1N)C(=O)N\N=C/1\CCCc2c\1[nH]c1c2cccc1 |
InChI: |
InChI=1/C20H17N5OS/c21-20-23-15-9-8-11(10-17(15)27-20)19(26)25-24-16-7-3-5-13-12-4-1-2-6-14(12)22-18(13)16/h1-2,4,6,8-10,22H,3,5,7H2,(H2,21,23)(H,25,26)/b24-16+ |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 375.456 g/mol | logS: -5.55506 | SlogP: 3.83017 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.00613256 | Sterimol/B1: 2.95089 | Sterimol/B2: 2.98044 | Sterimol/B3: 4.26864 |
Sterimol/B4: 5.62378 | Sterimol/L: 21.3259 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 632.588 | Positive charged surface: 359.509 | Negative charged surface: 267.235 | Volume: 340.75 |
Hydrophobic surface: 436.596 | Hydrophilic surface: 195.992 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |