 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(CCC(=O)[O-])C(=O)[O-])c1ccc(Nc2nc3c(cccc3)c(c2)C)cc1 |
| InChI: | InChI=1/C22H21N3O5/c1-13-12-19(24-17-5-3-2-4-16(13)17)23-15-8-6-14(7-9-15)21(28)25-18(22(29)30)10-11-20(26)27/h2-9,12,18H,10-11H2,1H3,(H,23,24)(H,25,28)(H,26,27)(H,29,30)/p-2/t18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=96.0335 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.41 g/mol | logS: -5.12132 | SlogP: 0.66522 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.044936 | Sterimol/B1: 2.51837 | Sterimol/B2: 4.79096 | Sterimol/B3: 4.79658 | |||
| Sterimol/B4: 7.72321 | Sterimol/L: 19.2375 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 677.554 | Positive charged surface: 341.974 | Negative charged surface: 330.675 | Volume: 375.125 | |||
| Hydrophobic surface: 432.786 | Hydrophilic surface: 244.768 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
