Type: Neutral
Formula: C11H15N5O4
SMILES: |
O1C(CO)C(O)(C)C(O)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C11H15N5O4/c1-11(19)5(2-17)20-10(7(11)18)16-4-15-6-8(12)13-3-14-9(6)16/h3-5,7,10,17-19H,2H2,1H3,(H2,12,13,14)/t5-,7-,10-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 281.272 g/mol | logS: -1.28989 | SlogP: -1.4944 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0930551 | Sterimol/B1: 2.22912 | Sterimol/B2: 3.63035 | Sterimol/B3: 4.71808 |
Sterimol/B4: 4.83349 | Sterimol/L: 13.6991 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 469.862 | Positive charged surface: 355.512 | Negative charged surface: 114.35 | Volume: 239.25 |
Hydrophobic surface: 170.122 | Hydrophilic surface: 299.74 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |