 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)C(N)c1ccccc1 |
| InChI: | InChI=1/C16H19N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23)/p-1/t9-,10+,11+,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=102.978 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 348.403 g/mol | logS: -3.36995 | SlogP: -0.9211 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.20462 | Sterimol/B1: 3.8301 | Sterimol/B2: 3.8863 | Sterimol/B3: 4.73146 | |||
| Sterimol/B4: 6.38929 | Sterimol/L: 12.7408 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 533.828 | Positive charged surface: 265.467 | Negative charged surface: 229.761 | Volume: 312.375 | |||
| Hydrophobic surface: 278.764 | Hydrophilic surface: 255.064 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
