Type: Neutral
Formula: C12H15FN2O6
SMILES: |
FC1=CN(C2OC(C3OC(OC23)(C)C)CO)C(=O)NC1=O |
InChI: |
InChI=1/C12H15FN2O6/c1-12(2)20-7-6(4-16)19-10(8(7)21-12)15-3-5(13)9(17)14-11(15)18/h3,6-8,10,16H,4H2,1-2H3,(H,14,17,18)/t6-,7-,8-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 302.258 g/mol | logS: -1.81047 | SlogP: -0.3047 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.174116 | Sterimol/B1: 2.13989 | Sterimol/B2: 2.51743 | Sterimol/B3: 4.93525 |
Sterimol/B4: 8.46139 | Sterimol/L: 13.5612 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 485.442 | Positive charged surface: 298.703 | Negative charged surface: 186.738 | Volume: 249.5 |
Hydrophobic surface: 258.089 | Hydrophilic surface: 227.353 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |