 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)C(NC)c1ccccc1 |
| InChI: | InChI=1/C17H21N3O4S/c1-17(2)12(16(23)24)20-14(22)11(15(20)25-17)19-13(21)10(18-3)9-7-5-4-6-8-9/h4-8,10-12,15,18H,1-3H3,(H,19,21)(H,23,24)/p-1/t10-,11-,12-,15-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.277 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 362.43 g/mol | logS: -3.44553 | SlogP: -0.6604 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.149552 | Sterimol/B1: 2.17266 | Sterimol/B2: 4.90393 | Sterimol/B3: 5.83663 | |||
| Sterimol/B4: 5.96758 | Sterimol/L: 14.0881 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 591.315 | Positive charged surface: 308.746 | Negative charged surface: 246.906 | Volume: 332.25 | |||
| Hydrophobic surface: 379.749 | Hydrophilic surface: 211.566 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
