 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(NC(CCCNC(=[NH2+])N)C(OC)=O)c1c2c(ccc1)c(N(C)C)ccc2 |
| InChI: | InChI=1/C19H27N5O4S/c1-24(2)16-10-4-8-14-13(16)7-5-11-17(14)29(26,27)23-15(18(25)28-3)9-6-12-22-19(20)21/h4-5,7-8,10-11,15,23H,6,9,12H2,1-3H3,(H4,20,21,22)/p+1/t15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-11.2246 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 422.53 g/mol | logS: -4.13601 | SlogP: -0.8307 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0969419 | Sterimol/B1: 4.31146 | Sterimol/B2: 4.99121 | Sterimol/B3: 5.15908 | |||
| Sterimol/B4: 5.95555 | Sterimol/L: 18.5114 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 667.931 | Positive charged surface: 503.939 | Negative charged surface: 159.835 | Volume: 398.25 | |||
| Hydrophobic surface: 436.481 | Hydrophilic surface: 231.45 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
