Type: Ionized
Formula: C7H9NO7-2
SMILES: |
OC(C(CC(=O)[O-])C)(C(=O)NO)C(=O)[O-] |
InChI: |
InChI=1/C7H11NO7/c1-3(2-4(9)10)7(14,6(12)13)5(11)8-15/h3,14-15H,2H2,1H3,(H,8,11)(H,9,10)(H,12,13)/p-2/t3-,7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 219.149 g/mol | logS: -0.26799 | SlogP: -4.2511 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.163346 | Sterimol/B1: 2.64687 | Sterimol/B2: 3.33823 | Sterimol/B3: 3.39214 |
Sterimol/B4: 5.49858 | Sterimol/L: 10.9369 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 363.623 | Positive charged surface: 152.54 | Negative charged surface: 211.083 | Volume: 171.625 |
Hydrophobic surface: 65.4018 | Hydrophilic surface: 298.2212 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|