 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12C1C(=CC[NH+](C1)CC)C(C#N)(C#N)C(=N)C2C#N |
| InChI: | InChI=1/C21H18N6O/c1-2-27-8-7-13-16(10-27)21(14-5-3-4-6-17(14)26-19(21)28)15(9-22)18(25)20(13,11-23)12-24/h3-7,15-16,25H,2,8,10H2,1H3,(H,26,28)/p+1/b25-18-/t15-,16+,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=75.1952 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 371.424 g/mol | logS: -3.34198 | SlogP: 0.544222 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.226833 | Sterimol/B1: 3.15532 | Sterimol/B2: 4.65968 | Sterimol/B3: 4.79552 | |||
| Sterimol/B4: 9.3164 | Sterimol/L: 12.9568 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 585.728 | Positive charged surface: 320.121 | Negative charged surface: 265.607 | Volume: 353.25 | |||
| Hydrophobic surface: 278.892 | Hydrophilic surface: 306.836 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
