Type: Neutral
Formula: C14H17N5O5
SMILES: |
O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2c(C#N)c1OCC |
InChI: |
InChI=1/C14H17N5O5/c1-2-23-13-6(3-15)8-11(16)17-5-18-12(8)19(13)14-10(22)9(21)7(4-20)24-14/h5,7,9-10,14,20-22H,2,4H2,1H3,(H2,16,17,18)/t7-,9+,10+,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 335.32 g/mol | logS: -2.34522 | SlogP: -1.00912 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.130309 | Sterimol/B1: 2.13182 | Sterimol/B2: 3.75165 | Sterimol/B3: 4.38879 |
Sterimol/B4: 9.84141 | Sterimol/L: 13.7091 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 544.739 | Positive charged surface: 390.96 | Negative charged surface: 148.423 | Volume: 291.625 |
Hydrophobic surface: 216.651 | Hydrophilic surface: 328.088 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |