Type: Neutral
Formula: C13H25NO8
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1OCC(OC)COC |
InChI: |
InChI=1/C13H25NO8/c1-7(16)14-10-12(18)11(17)9(4-15)22-13(10)21-6-8(20-3)5-19-2/h8-13,15,17-18H,4-6H2,1-3H3,(H,14,16)/t8-,9+,10-,11-,12+,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.342 g/mol | logS: 0.23702 | SlogP: -2.3919 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.107557 | Sterimol/B1: 2.10209 | Sterimol/B2: 2.50441 | Sterimol/B3: 5.47211 |
Sterimol/B4: 9.44511 | Sterimol/L: 15.0415 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.628 | Positive charged surface: 498.346 | Negative charged surface: 91.2824 | Volume: 296.125 |
Hydrophobic surface: 426.2 | Hydrophilic surface: 163.428 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |