Type: Neutral
Formula: C19H30O2
SMILES: |
OC1CCC2C3C(CCC12C)C1(C(CC(O)CC1)C=C3)C |
InChI: |
InChI=1/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,12-17,20-21H,5-11H2,1-2H3/t12-,13-,14+,15-,16-,17-,18-,19+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 290.447 g/mol | logS: -3.4881 | SlogP: 3.5269 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.217698 | Sterimol/B1: 2.49553 | Sterimol/B2: 3.15119 | Sterimol/B3: 5.34687 |
Sterimol/B4: 5.40806 | Sterimol/L: 13.2299 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 483.759 | Positive charged surface: 372.736 | Negative charged surface: 111.023 | Volume: 301.25 |
Hydrophobic surface: 347.487 | Hydrophilic surface: 136.272 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 8 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |