Type: Neutral
Formula: C5H13NO8P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)CNCCC(O)=O |
InChI: |
InChI=1/C5H13NO8P2/c7-4(8)1-2-6-3-5(15(9,10)11)16(12,13)14/h5-6H,1-3H2,(H,7,8)(H2,9,10,11)(H2,12,13,14) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 277.106 g/mol | logS: 2.22307 | SlogP: -3.4082 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.145209 | Sterimol/B1: 2.66505 | Sterimol/B2: 3.98641 | Sterimol/B3: 4.26193 |
Sterimol/B4: 4.89038 | Sterimol/L: 12.9863 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 431.602 | Positive charged surface: 251.306 | Negative charged surface: 180.296 | Volume: 202.75 |
Hydrophobic surface: 109.099 | Hydrophilic surface: 322.503 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 9 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |