Type: Neutral
Formula: C8H13O9P
SMILES: |
P(O)(O)(=O)C(CCC(O)=O)(CCC(O)=O)C(O)=O |
InChI: |
InChI=1/C8H13O9P/c9-5(10)1-3-8(7(13)14,18(15,16)17)4-2-6(11)12/h1-4H2,(H,9,10)(H,11,12)(H,13,14)(H2,15,16,17) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.157 g/mol | logS: 0.92408 | SlogP: -1.3531 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.251288 | Sterimol/B1: 3.20131 | Sterimol/B2: 3.84348 | Sterimol/B3: 4.55669 |
Sterimol/B4: 6.07132 | Sterimol/L: 12.6348 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 439.385 | Positive charged surface: 247.15 | Negative charged surface: 192.235 | Volume: 215.375 |
Hydrophobic surface: 70.5283 | Hydrophilic surface: 368.8567 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 9 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|