Type: Neutral
Formula: C20H26O3
SMILES: |
O(C(=O)C)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C |
InChI: |
InChI=1/C20H26O3/c1-12(21)23-14-4-6-15-13(11-14)3-5-17-16(15)9-10-20(2)18(17)7-8-19(20)22/h4,6,11,16-19,22H,3,5,7-10H2,1-2H3/t16-,17+,18+,19-,20-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.425 g/mol | logS: -4.93386 | SlogP: 3.82887 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0757935 | Sterimol/B1: 3.60903 | Sterimol/B2: 3.68289 | Sterimol/B3: 3.9607 |
Sterimol/B4: 4.74548 | Sterimol/L: 15.9798 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 539.71 | Positive charged surface: 373.797 | Negative charged surface: 165.914 | Volume: 314.375 |
Hydrophobic surface: 438.251 | Hydrophilic surface: 101.459 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |