 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(CCNC(=O)C)C=1CC2N(C(=O)C2C(O)(C)C)C=1C(=O)[O-] |
| InChI: | InChI=1/C14H20N2O6S/c1-7(17)15-4-5-23(22)9-6-8-10(14(2,3)21)12(18)16(8)11(9)13(19)20/h8,10,21H,4-6H2,1-3H3,(H,15,17)(H,19,20)/p-1/t8-,10-,23+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=58.5419 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 343.38 g/mol | logS: -1.37887 | SlogP: -2.1657 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.10366 | Sterimol/B1: 2.33822 | Sterimol/B2: 2.94297 | Sterimol/B3: 5.75864 | |||
| Sterimol/B4: 7.70181 | Sterimol/L: 15.9755 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 567.488 | Positive charged surface: 318.57 | Negative charged surface: 224.751 | Volume: 300.375 | |||
| Hydrophobic surface: 291.94 | Hydrophilic surface: 275.548 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
