Type: Neutral
Formula: C11H13FN2O5
SMILES: |
FC1C(O)C(OC1N1C=C(C=C)C(=O)NC1=O)CO |
InChI: |
InChI=1/C11H13FN2O5/c1-2-5-3-14(11(18)13-9(5)17)10-7(12)8(16)6(4-15)19-10/h2-3,6-8,10,15-16H,1,4H2,(H,13,17,18)/t6-,7+,8-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.232 g/mol | logS: -1.21715 | SlogP: -0.5558 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.118094 | Sterimol/B1: 3.22365 | Sterimol/B2: 3.60058 | Sterimol/B3: 3.78675 |
Sterimol/B4: 4.02415 | Sterimol/L: 14.0631 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 456.721 | Positive charged surface: 282.789 | Negative charged surface: 173.932 | Volume: 223.625 |
Hydrophobic surface: 195.155 | Hydrophilic surface: 261.566 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |