Type: Neutral
Formula: C19H25N3O3
SMILES: |
O=C1NC(Cc2c3c(N(C)C1C(C)C)cccc3[nH]c2)COC(=O)C |
InChI: |
InChI=1/C19H25N3O3/c1-11(2)18-19(24)21-14(10-25-12(3)23)8-13-9-20-15-6-5-7-16(17(13)15)22(18)4/h5-7,9,11,14,18,20H,8,10H2,1-4H3,(H,21,24)/t14-,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 343.427 g/mol | logS: -3.10491 | SlogP: 2.23267 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.168896 | Sterimol/B1: 2.56423 | Sterimol/B2: 3.07447 | Sterimol/B3: 5.30827 |
Sterimol/B4: 7.5843 | Sterimol/L: 14.5562 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 534.143 | Positive charged surface: 356.244 | Negative charged surface: 174.933 | Volume: 329 |
Hydrophobic surface: 386.346 | Hydrophilic surface: 147.797 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |